Cationic polymers,also known as polycations,are considered to be the most potential non-viral gene carriers due to their unique advantages such as the ability to bind the negative charge of nucleic acid molecules.Mult...Cationic polymers,also known as polycations,are considered to be the most potential non-viral gene carriers due to their unique advantages such as the ability to bind the negative charge of nucleic acid molecules.Multicomponent polymerization(MCP)is a one-step,tandem strategy to construct complex structures based on multicomponent reactions.Herein,we developed a metal-free MCP method based on three monomers of p-dinitrovinylbenzene(p-DNVB),1,1-dimethylethyl N,N-dibromocarbamate(BocNBr_(2)),and bis-secondary-amines with a ratio of 1:2:1,to access a library of Boc-substituted polyamidines with well-defined structures and suitable molecular weights(M w ranging from 4400Da to 11,000Da)in high yields(up to 85%)under mild conditions.Upon the removal of Boc groups,a series of water-soluble polymers with cationic property were prepared and their gene binding capability was further evaluated.展开更多
基金supported by the National Science Founda-tion of China(No.21978039)Special Funds of the Central Gov-ernment Leading Local Government for the Technology Develop-ment(Nos.2021JH6/10500148,2021JH6/10500146)Fundamental Research Funds for the Central Universities(Nos.DUT21YG133,DUT20YG120).
文摘Cationic polymers,also known as polycations,are considered to be the most potential non-viral gene carriers due to their unique advantages such as the ability to bind the negative charge of nucleic acid molecules.Multicomponent polymerization(MCP)is a one-step,tandem strategy to construct complex structures based on multicomponent reactions.Herein,we developed a metal-free MCP method based on three monomers of p-dinitrovinylbenzene(p-DNVB),1,1-dimethylethyl N,N-dibromocarbamate(BocNBr_(2)),and bis-secondary-amines with a ratio of 1:2:1,to access a library of Boc-substituted polyamidines with well-defined structures and suitable molecular weights(M w ranging from 4400Da to 11,000Da)in high yields(up to 85%)under mild conditions.Upon the removal of Boc groups,a series of water-soluble polymers with cationic property were prepared and their gene binding capability was further evaluated.
