Co-crystallization of pztcH_4 with 4,4'-bipyridine(4,4'-bipy) in pH = 3-4 and 1-2 gave two new binary molecular adducts: [(4,4'-bipy H2)(pztc H2)](1) and [(4,4'-bipy H2)(pztcH3)(Cl)]·4H2O(2),...Co-crystallization of pztcH_4 with 4,4'-bipyridine(4,4'-bipy) in pH = 3-4 and 1-2 gave two new binary molecular adducts: [(4,4'-bipy H2)(pztc H2)](1) and [(4,4'-bipy H2)(pztcH3)(Cl)]·4H2O(2), respectively. Compounds 1 and 2 have been characterized by IR, elemental analysis, NMR and X-ray single-crystal diffraction. Compound 1 crystallizes in triclinic, space group P1 with a = 5.7752(12), b = 7.9126(16), c = 9.4492(19) ?, α = 97.49(3), β = 107.71(3), γ = 94.52(3)o, V = 404.62(14) A^3, Z = 1, μ = 0.137 mm^1, Dc = 1.692 Mg/m^3, C18H12N4O8, Mr = 412.32, F(000) = 212, S = 1.025, R = 0.0360 and wR = 0.0973. Compound 2 crystallizes in monoclinic, space group C2/c with a = 17.093(3), b = 7.7665(16), c = 18.414(4) A, β = 113.36(3)o, V = 2244.1(8) A^3, Z = 4, μ = 0.244 mm^-1, Dc = 1.542 Mg/m^3, C18H21ClN4O12, Mr = 520.84, F(000) = 1080, S = 1.021, R = 0.0343 and wR = 0.0978. In compound 1, pztc H22- anions self-formed 2-D sheets by strong Oacid-H···Oacidhydrogen bonds, which are further extended to form a 3-D supramolecular network bridged with 4,4?-bipy via N-H···Oacid interactions. In compound 2, besides the 1-D chain constructed by pztc H3-itself through strong H-bond Oacid-H···Oacid, the other chain is constructed with 4,4?-bipy H22+, Cl-anion and water molecules by moderate H-bonds and Ow-H···Cl and N-H···Ow. The two chains are linked with μ3-connected water molecules resulting from the combination of strong synthon-assisted H-bonding Oacid-H···Ow to afford an interlaced 3-D network.展开更多
A new metal-organic coordination polymer [Zn(pzdc)(mbix)]n·nH2O(H2pzdc = pyrazine-2,3- dicarboxylic acid, mbix = 1,3-bis(imidazol-1-ylmethyl)-benzene) 1 has been hydrothermally synthesized and structurall...A new metal-organic coordination polymer [Zn(pzdc)(mbix)]n·nH2O(H2pzdc = pyrazine-2,3- dicarboxylic acid, mbix = 1,3-bis(imidazol-1-ylmethyl)-benzene) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR, TG, fluorescence spectrum and single-crystal X-ray diffraction. Yellow crystals crystallize in monoclinic system, space group P21/n with a = 8.5519(6), b = 14.8764(10), c = 16.4108(11) A, β = 103.4520(10)o, V = 2030.5(2)A^3, C(20)H(18)N6O5Zn, Mr = 487.77, Dc = 1.596 g/cm^3, F(000) = 1000, Z = 4, μ(MoK α) = 1.257 mm^-1, the final R = 0.0260 and w R = 0.0706 for 3445 observed reflections(I 〉 2σ(I)). The structure of 1 exhibits a one-dimensional chain-like structure. In addition, natural bond orbital(NBO) analysis was performed by the PBE0/LANL2DZ method in Gaussian 03 Program. The calculation results show obvious covalent interaction between the coordinated atoms and Zn(Ⅱ) ion.展开更多
The title complex, [Mn(DPPZ)(PZDC)(H2O)] 1 (DPPZ = dipyrido[3,2 -a:2',3'- c]phenazine and H2PZDC = pyrazine-2,3-dicarboxylic acid), has been hydrothermally synthesized and structurally characterized by X-ra...The title complex, [Mn(DPPZ)(PZDC)(H2O)] 1 (DPPZ = dipyrido[3,2 -a:2',3'- c]phenazine and H2PZDC = pyrazine-2,3-dicarboxylic acid), has been hydrothermally synthesized and structurally characterized by X-ray single-crystal diffraction, elemental analyses, IR, TG- DTA and magnetic susceptibility measurement. It crystallizes in triclinic, space group P1^- with a = 6.6842(5), b = 7.5741(6), c = 20.5755(15)A, α = 90.1160(10), β = 97.0560(10), γ = 97.3350(10)°, V= 1025.16(13)A^3, Z = 2, MnC24H14N6O5, Mr= 521.35, Dc= 1.689 g/cm^3, F(000) = 530, μ(MoKa) = 0.699 mm^-1, R = 0.0366 and wR = 0.0810. Compound 1 contains one- dimensional chains which are further stacked through π-π interactions to form a 3D supramolecular architecture. The water molecule O(1W) is involved in hydrogen bonding interactions with symmetric carboxylate oxygen atom 0(4) at (x+ 1, y+1, z) and symmetric PZDC nitrogen atom N(6) at (1-x, 1-y, 1-z), which completes the structure of 1. Magnetic susceptibility measurement indicates that the compound behaves a weak antiferromagnetic exchange interaction.展开更多
A novel pyrazine-2,3-dicarboxylic acid bridged Co(II) phen complex 2 ∞ [Co- ...A novel pyrazine-2,3-dicarboxylic acid bridged Co(II) phen complex 2 ∞ [Co- (phen)(μ-L)3/3]?H2O (H2L = pyrazine-2,3-dicarboxylic acid) has been hydrothermally synthesized, and X-ray single-crystal diffraction analysis shows that it crystallizes in the monoclinic system, space group P21/n with a = 11.480(2), b = 11.885(2), c = 12.939(3) ?, β = 110.55(3)°, V = 1653.1(6) ?3, Mr = 423.25, Dc = 0.425 g/cm3, Z = 4, R = 0.0361 and wR = 0.1011. The title complex consists of 2D 2 ∞ [Co(phen)(μ-L)3/3] layers and crystal water molecules. Each Co atom is octahedrally coordinated by three N atoms and three O atoms to form 2D 2 ∞ [Co(phen)(μ-L)3/3] polymeric layers. Furthermore, such 2D layers are stacked into 3D supramolecular frameworks via Van der Waals’ intermolecular forces, strong and weak hydrogen-bond interactions. The coordination phen and crystal water molecules are resided into cavities of the frameworks.展开更多
The reaction of furan-2,3-diones with S-methylisothiosemicarbazide hydroiodide yielded novel 1,2,4- triazine-5(4H)-ones, and reaction of furan-2,3-diones with diaminomaleonitrile led to the formation of pyrazine-2,3...The reaction of furan-2,3-diones with S-methylisothiosemicarbazide hydroiodide yielded novel 1,2,4- triazine-5(4H)-ones, and reaction of furan-2,3-diones with diaminomaleonitrile led to the formation of pyrazine-2,3-dicarbonitrile derivatives, and the hydrolysis of these products led to the formation of more new pyrazine-2,3-dicarbonitrile derivatives. These compounds are potential herbicides and pesticides.展开更多
8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O (1) was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent meas...8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O (1) was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent measurements. Compound 1 crystallizes in orthorhombic, space group Pbcn with a = 9.953(3), b = 15.966(3), c = 16.081(5) A, V = 2555.5(13) A3, Z = 4, μ = 0.122 mm^-1, Dc = 1.514 Mg/m3, T= 296(2) K, C26H22N4O12, Mr = 582.48, F(000) = 1208, S = 1.006, R = 0.0448 and wR = 0.1149. Compound 1 has a three-dimensional (3D) network, in which pyra- zine-2,3,5,6-tetracarboxylic acids build up two-dimensional (2D) sheets and 8-hydroxyquinoline cations and water molecules act as pillars to connect the 2D sheets into an extended 3D network through strong intermolecular hydrogen bonding and π…π stacking interactions. Especially, a very short O-H…O hydrogen bond (O…O 2.470(2) A) between two neighboring [H2pztc] anions was observed.展开更多
基金supported by the National Natural Science Foundation of China(No.21571094)
文摘Co-crystallization of pztcH_4 with 4,4'-bipyridine(4,4'-bipy) in pH = 3-4 and 1-2 gave two new binary molecular adducts: [(4,4'-bipy H2)(pztc H2)](1) and [(4,4'-bipy H2)(pztcH3)(Cl)]·4H2O(2), respectively. Compounds 1 and 2 have been characterized by IR, elemental analysis, NMR and X-ray single-crystal diffraction. Compound 1 crystallizes in triclinic, space group P1 with a = 5.7752(12), b = 7.9126(16), c = 9.4492(19) ?, α = 97.49(3), β = 107.71(3), γ = 94.52(3)o, V = 404.62(14) A^3, Z = 1, μ = 0.137 mm^1, Dc = 1.692 Mg/m^3, C18H12N4O8, Mr = 412.32, F(000) = 212, S = 1.025, R = 0.0360 and wR = 0.0973. Compound 2 crystallizes in monoclinic, space group C2/c with a = 17.093(3), b = 7.7665(16), c = 18.414(4) A, β = 113.36(3)o, V = 2244.1(8) A^3, Z = 4, μ = 0.244 mm^-1, Dc = 1.542 Mg/m^3, C18H21ClN4O12, Mr = 520.84, F(000) = 1080, S = 1.021, R = 0.0343 and wR = 0.0978. In compound 1, pztc H22- anions self-formed 2-D sheets by strong Oacid-H···Oacidhydrogen bonds, which are further extended to form a 3-D supramolecular network bridged with 4,4?-bipy via N-H···Oacid interactions. In compound 2, besides the 1-D chain constructed by pztc H3-itself through strong H-bond Oacid-H···Oacid, the other chain is constructed with 4,4?-bipy H22+, Cl-anion and water molecules by moderate H-bonds and Ow-H···Cl and N-H···Ow. The two chains are linked with μ3-connected water molecules resulting from the combination of strong synthon-assisted H-bonding Oacid-H···Ow to afford an interlaced 3-D network.
基金supported by the Science and Technology Development Project of Jilin Provincial Science&Technology Department(201205080)the Science and Technology Research Projects of the Education Office of Jilin Province(No.2013.384)
文摘A new metal-organic coordination polymer [Zn(pzdc)(mbix)]n·nH2O(H2pzdc = pyrazine-2,3- dicarboxylic acid, mbix = 1,3-bis(imidazol-1-ylmethyl)-benzene) 1 has been hydrothermally synthesized and structurally characterized by elemental analysis, IR, TG, fluorescence spectrum and single-crystal X-ray diffraction. Yellow crystals crystallize in monoclinic system, space group P21/n with a = 8.5519(6), b = 14.8764(10), c = 16.4108(11) A, β = 103.4520(10)o, V = 2030.5(2)A^3, C(20)H(18)N6O5Zn, Mr = 487.77, Dc = 1.596 g/cm^3, F(000) = 1000, Z = 4, μ(MoK α) = 1.257 mm^-1, the final R = 0.0260 and w R = 0.0706 for 3445 observed reflections(I 〉 2σ(I)). The structure of 1 exhibits a one-dimensional chain-like structure. In addition, natural bond orbital(NBO) analysis was performed by the PBE0/LANL2DZ method in Gaussian 03 Program. The calculation results show obvious covalent interaction between the coordinated atoms and Zn(Ⅱ) ion.
基金The project was supported by the Natural Science Foundation of Jilin Province (No. 20060516)the Doctoral Foundation of Jilin Normal University (No. 2006006)+1 种基金the Science and Technology Institute Foundation of Siping City (No. 2005016)the Subject and Base Construction Foundation of Jilin Normal University (No. 2006041)
文摘The title complex, [Mn(DPPZ)(PZDC)(H2O)] 1 (DPPZ = dipyrido[3,2 -a:2',3'- c]phenazine and H2PZDC = pyrazine-2,3-dicarboxylic acid), has been hydrothermally synthesized and structurally characterized by X-ray single-crystal diffraction, elemental analyses, IR, TG- DTA and magnetic susceptibility measurement. It crystallizes in triclinic, space group P1^- with a = 6.6842(5), b = 7.5741(6), c = 20.5755(15)A, α = 90.1160(10), β = 97.0560(10), γ = 97.3350(10)°, V= 1025.16(13)A^3, Z = 2, MnC24H14N6O5, Mr= 521.35, Dc= 1.689 g/cm^3, F(000) = 530, μ(MoKa) = 0.699 mm^-1, R = 0.0366 and wR = 0.0810. Compound 1 contains one- dimensional chains which are further stacked through π-π interactions to form a 3D supramolecular architecture. The water molecule O(1W) is involved in hydrogen bonding interactions with symmetric carboxylate oxygen atom 0(4) at (x+ 1, y+1, z) and symmetric PZDC nitrogen atom N(6) at (1-x, 1-y, 1-z), which completes the structure of 1. Magnetic susceptibility measurement indicates that the compound behaves a weak antiferromagnetic exchange interaction.
基金This work was supported by the Science and Technology Bureau of Jinhua City (No 2003-01-179)
文摘A novel pyrazine-2,3-dicarboxylic acid bridged Co(II) phen complex 2 ∞ [Co- (phen)(μ-L)3/3]?H2O (H2L = pyrazine-2,3-dicarboxylic acid) has been hydrothermally synthesized, and X-ray single-crystal diffraction analysis shows that it crystallizes in the monoclinic system, space group P21/n with a = 11.480(2), b = 11.885(2), c = 12.939(3) ?, β = 110.55(3)°, V = 1653.1(6) ?3, Mr = 423.25, Dc = 0.425 g/cm3, Z = 4, R = 0.0361 and wR = 0.1011. The title complex consists of 2D 2 ∞ [Co(phen)(μ-L)3/3] layers and crystal water molecules. Each Co atom is octahedrally coordinated by three N atoms and three O atoms to form 2D 2 ∞ [Co(phen)(μ-L)3/3] polymeric layers. Furthermore, such 2D layers are stacked into 3D supramolecular frameworks via Van der Waals’ intermolecular forces, strong and weak hydrogen-bond interactions. The coordination phen and crystal water molecules are resided into cavities of the frameworks.
基金financially supported by the Center of Research Projects of Bozok University (No. IFE 2011/46)
文摘The reaction of furan-2,3-diones with S-methylisothiosemicarbazide hydroiodide yielded novel 1,2,4- triazine-5(4H)-ones, and reaction of furan-2,3-diones with diaminomaleonitrile led to the formation of pyrazine-2,3-dicarbonitrile derivatives, and the hydrolysis of these products led to the formation of more new pyrazine-2,3-dicarbonitrile derivatives. These compounds are potential herbicides and pesticides.
基金supported by the National Natural Science Foundation of China(No.21162015)Science Foundation of State Key Laboratory of Structural Chemistry(No.20100009)
文摘8-Hydroxyquinoline salt of pyrazine-2,3,5,6-tetracarboxylic acid [HQ]2[H2pztc]· 2H2O (1) was prepared and characterized by single-crystal X-ray diffraction, NMR, IR, TGA, elemental analysis and fluorescent measurements. Compound 1 crystallizes in orthorhombic, space group Pbcn with a = 9.953(3), b = 15.966(3), c = 16.081(5) A, V = 2555.5(13) A3, Z = 4, μ = 0.122 mm^-1, Dc = 1.514 Mg/m3, T= 296(2) K, C26H22N4O12, Mr = 582.48, F(000) = 1208, S = 1.006, R = 0.0448 and wR = 0.1149. Compound 1 has a three-dimensional (3D) network, in which pyra- zine-2,3,5,6-tetracarboxylic acids build up two-dimensional (2D) sheets and 8-hydroxyquinoline cations and water molecules act as pillars to connect the 2D sheets into an extended 3D network through strong intermolecular hydrogen bonding and π…π stacking interactions. Especially, a very short O-H…O hydrogen bond (O…O 2.470(2) A) between two neighboring [H2pztc] anions was observed.